C14H22N2O6 — CID 23405286
bis[(2S)-2-aminopropanoyl] cyclohexane-1,1-dicarboxylate (PubChem CID 23405286) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is bis[(2S)-2-aminopropanoyl] cyclohexane-1,1-dicarboxylate.
| Compound Name | bis[(2S)-2-aminopropanoyl] cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 23405286 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | bis[(2S)-2-aminopropanoyl] cyclohexane-1,1-dicarboxylate |
| SMILES | C[C@H](N)C(=O)OC(=O)C1(C(=O)OC(=O)[C@H](C)N)CCCCC1 |
| InChI | InChI=1S/C14H22N2O6/c1-8(15)10(17)21-12(19)14(6-4-3-5-7-14)13(20)22-11(18)9(2)16/h8-9H,3-7,15-16H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | NDTYYXHDVMBZND-IUCAKERBSA-N |
| XLogP | -0.23 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|