C11H10N4O2S — CID 23412186
methyl 3-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate (PubChem CID 23412186) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is methyl 3-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate.
| Compound Name | methyl 3-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate |
|---|---|
| PubChem CID | 23412186 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | methyl 3-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2cn[nH]c(=S)n2)c1 |
| InChI | InChI=1S/C11H10N4O2S/c1-17-10(16)7-3-2-4-8(5-7)13-9-6-12-15-11(18)14-9/h2-6H,1H3,(H2,13,14,15,18) |
| InChIKey | BQOURXMOYYCNHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|