C51H49NO10P2 — CID 23421516
N-[3,4-bis(phenylmethoxy)phenyl]-3,3-bis[bis(phenylmethoxy)phosphoryl]-3-hydroxypropanamide (PubChem CID 23421516) has the molecular formula C51H49NO10P2 and a molecular weight of 897.90 g/mol. Its IUPAC name is N-[3,4-bis(phenylmethoxy)phenyl]-3,3-bis[bis(phenylmethoxy)phosphoryl]-3-hydroxypropanamide.
| Compound Name | N-[3,4-bis(phenylmethoxy)phenyl]-3,3-bis[bis(phenylmethoxy)phosphoryl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 23421516 |
| Molecular Formula | C51H49NO10P2 |
| Molecular Weight | 897.90 g/mol |
| Exact Mass | 897.28 |
| IUPAC Name | N-[3,4-bis(phenylmethoxy)phenyl]-3,3-bis[bis(phenylmethoxy)phosphoryl]-3-hydroxypropanamide |
| SMILES | O=C(CC(O)(P(=O)(OCc1ccccc1)OCc1ccccc1)P(=O)(OCc1ccccc1)OCc1ccccc1)Nc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C51H49NO10P2/c53-50(52-47-31-32-48(57-35-41-19-7-1-8-20-41)49(33-47)58-36-42-21-9-2-10-22-42)34-51(54,63(55,59-37-43-23-11-3-12-24-43)60-38-44-25-13-4-14-26-44)64(56,61-39-45-27-15-5-16-28-45)62-40-46-29-17-6-18-30-46/h1-33,54H,34-40H2,(H,52,53) |
| InChIKey | XRWDLJWVAAICBH-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.90 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|