C24H21NO6 — CID 67849323
2-[[3,4-bis(phenylmethoxy)anilino]methylidene]propanedioic acid (PubChem CID 67849323) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-[[3,4-bis(phenylmethoxy)anilino]methylidene]propanedioic acid.
| Compound Name | 2-[[3,4-bis(phenylmethoxy)anilino]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 67849323 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[[3,4-bis(phenylmethoxy)anilino]methylidene]propanedioic acid |
| SMILES | O=C(O)C(=CNc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C24H21NO6/c26-23(27)20(24(28)29)14-25-19-11-12-21(30-15-17-7-3-1-4-8-17)22(13-19)31-16-18-9-5-2-6-10-18/h1-14,25H,15-16H2,(H,26,27)(H,28,29) |
| InChIKey | SAWMNLXUCVDVBI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|