C11H24O9P2 — CID 23421899
1,1-bis(dimethoxyphosphoryl)ethyl 2-methylpropyl carbonate (PubChem CID 23421899) has the molecular formula C11H24O9P2 and a molecular weight of 362.25 g/mol. Its IUPAC name is 1,1-bis(dimethoxyphosphoryl)ethyl 2-methylpropyl carbonate.
| Compound Name | 1,1-bis(dimethoxyphosphoryl)ethyl 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 23421899 |
| Molecular Formula | C11H24O9P2 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1,1-bis(dimethoxyphosphoryl)ethyl 2-methylpropyl carbonate |
| SMILES | COP(=O)(OC)C(C)(OC(=O)OCC(C)C)P(=O)(OC)OC |
| InChI | InChI=1S/C11H24O9P2/c1-9(2)8-19-10(12)20-11(3,21(13,15-4)16-5)22(14,17-6)18-7/h9H,8H2,1-7H3 |
| InChIKey | XYBDPIVGCODLBC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|