C7H4N4O3 — CID 23422183
4,7-dioxo-4a,8-dihydropteridine-6-carbaldehyde (PubChem CID 23422183) has the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. Its IUPAC name is 4,7-dioxo-4a,8-dihydropteridine-6-carbaldehyde.
| Compound Name | 4,7-dioxo-4a,8-dihydropteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 23422183 |
| Molecular Formula | C7H4N4O3 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 4,7-dioxo-4a,8-dihydropteridine-6-carbaldehyde |
| SMILES | O=CC1=NC2C(=O)N=CN=C2NC1=O |
| InChI | InChI=1S/C7H4N4O3/c12-1-3-6(13)11-5-4(10-3)7(14)9-2-8-5/h1-2,4H,(H,8,9,11,13,14) |
| InChIKey | CDZGPIXYRGEUBP-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|