C7H6N4O2 — CID 23422181
6-methyl-4a,8-dihydropteridine-4,7-dione (PubChem CID 23422181) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 6-methyl-4a,8-dihydropteridine-4,7-dione.
| Compound Name | 6-methyl-4a,8-dihydropteridine-4,7-dione |
|---|---|
| PubChem CID | 23422181 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 6-methyl-4a,8-dihydropteridine-4,7-dione |
| SMILES | CC1=NC2C(=O)N=CN=C2NC1=O |
| InChI | InChI=1S/C7H6N4O2/c1-3-6(12)11-5-4(10-3)7(13)9-2-8-5/h2,4H,1H3,(H,8,9,11,12,13) |
| InChIKey | OOGNXPWFVLESOL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |