C6H4N4O2 — CID 23422151
4a,8-dihydropteridine-4,7-dione (PubChem CID 23422151) has the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. Its IUPAC name is 4a,8-dihydropteridine-4,7-dione.
| Compound Name | 4a,8-dihydropteridine-4,7-dione |
|---|---|
| PubChem CID | 23422151 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 4a,8-dihydropteridine-4,7-dione |
| SMILES | O=C1C=NC2C(=O)N=CN=C2N1 |
| InChI | InChI=1S/C6H4N4O2/c11-3-1-7-4-5(10-3)8-2-9-6(4)12/h1-2,4H,(H,8,9,10,11,12) |
| InChIKey | XASNZPQFNAONHY-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |