C6H4N4O3 — CID 23422163
4a,8-dihydropteridine-2,4,7-trione (PubChem CID 23422163) has the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. Its IUPAC name is 4a,8-dihydropteridine-2,4,7-trione.
| Compound Name | 4a,8-dihydropteridine-2,4,7-trione |
|---|---|
| PubChem CID | 23422163 |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 4a,8-dihydropteridine-2,4,7-trione |
| SMILES | O=C1C=NC2C(=O)NC(=O)N=C2N1 |
| InChI | InChI=1S/C6H4N4O3/c11-2-1-7-3-4(8-2)9-6(13)10-5(3)12/h1,3H,(H2,8,9,10,11,12,13) |
| InChIKey | WTBJGMLFPLYDLU-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |