C7H11N3O2 — CID 71652011
5-(dimethylamino)-6-methyl-5H-pyrimidine-2,4-dione (PubChem CID 71652011) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(dimethylamino)-6-methyl-5H-pyrimidine-2,4-dione.
| Compound Name | 5-(dimethylamino)-6-methyl-5H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71652011 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-(dimethylamino)-6-methyl-5H-pyrimidine-2,4-dione |
| SMILES | CC1=NC(=O)NC(=O)C1N(C)C |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(10(2)3)6(11)9-7(12)8-4/h5H,1-3H3,(H,9,11,12) |
| InChIKey | PJOVPXKKBVLACL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |