C6H4ClN3O — CID 71304027
7-chloro-3,7-dihydroimidazo[4,5-c]pyridin-2-one (PubChem CID 71304027) has the molecular formula C6H4ClN3O and a molecular weight of 169.57 g/mol. Its IUPAC name is 7-chloro-3,7-dihydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | 7-chloro-3,7-dihydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 71304027 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 7-chloro-3,7-dihydroimidazo[4,5-c]pyridin-2-one |
| SMILES | O=C1N=C2C(=CN=CC2Cl)N1 |
| InChI | InChI=1S/C6H4ClN3O/c7-3-1-8-2-4-5(3)10-6(11)9-4/h1-3H,(H,9,11) |
| InChIKey | SLBWKVASEQCNAX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|