C7H5ClN2O3S — CID 71651743
2-oxo-3,5-dihydrobenzimidazole-5-sulfonyl chloride (PubChem CID 71651743) has the molecular formula C7H5ClN2O3S and a molecular weight of 232.65 g/mol. Its IUPAC name is 2-oxo-3,5-dihydrobenzimidazole-5-sulfonyl chloride.
| Compound Name | 2-oxo-3,5-dihydrobenzimidazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 71651743 |
| Molecular Formula | C7H5ClN2O3S |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 2-oxo-3,5-dihydrobenzimidazole-5-sulfonyl chloride |
| SMILES | O=C1N=C2C=CC(S(=O)(=O)Cl)C=C2N1 |
| InChI | InChI=1S/C7H5ClN2O3S/c8-14(12,13)4-1-2-5-6(3-4)10-7(11)9-5/h1-4H,(H,10,11) |
| InChIKey | DESUFUPUNIDWSS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |