C6H4ClN3O — CID 71303716
5-chloro-3,5-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 71303716) has the molecular formula C6H4ClN3O and a molecular weight of 169.57 g/mol. Its IUPAC name is 5-chloro-3,5-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-chloro-3,5-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 71303716 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 5-chloro-3,5-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | O=C1N=C2C=CC(Cl)N=C2N1 |
| InChI | InChI=1S/C6H4ClN3O/c7-4-2-1-3-5(9-4)10-6(11)8-3/h1-2,4H,(H,9,10,11) |
| InChIKey | KNBANILTCUSJNT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|