C7H8N6O — CID 141391537
2-amino-4-imino-6-methyl-4a,8-dihydropteridin-7-one (PubChem CID 141391537) has the molecular formula C7H8N6O and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-amino-4-imino-6-methyl-4a,8-dihydropteridin-7-one.
| Compound Name | 2-amino-4-imino-6-methyl-4a,8-dihydropteridin-7-one |
|---|---|
| PubChem CID | 141391537 |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-amino-4-imino-6-methyl-4a,8-dihydropteridin-7-one |
| SMILES | [H]/N=C1\N=C(N)N=C2NC(=O)C(C)=NC21 |
| InChI | InChI=1S/C7H8N6O/c1-2-6(14)12-5-3(10-2)4(8)11-7(9)13-5/h3H,1H3,(H4,8,9,11,12,13,14) |
| InChIKey | MORJFTYJKMBWTH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|