C6H5N5O — CID 167994518
4-imino-4a,8-dihydropteridin-7-one (PubChem CID 167994518) has the molecular formula C6H5N5O and a molecular weight of 163.14 g/mol. Its IUPAC name is 4-imino-4a,8-dihydropteridin-7-one.
| Compound Name | 4-imino-4a,8-dihydropteridin-7-one |
|---|---|
| PubChem CID | 167994518 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 4-imino-4a,8-dihydropteridin-7-one |
| SMILES | [H]/N=C1\N=CN=C2NC(=O)C=NC21 |
| InChI | InChI=1S/C6H5N5O/c7-5-4-6(10-2-9-5)11-3(12)1-8-4/h1-2,4H,(H2,7,9,10,11,12) |
| InChIKey | BJJDKSMNEKQPCJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|