C6H5N5O2 — CID 135755303
2-amino-4a,8-dihydropteridine-4,7-dione (PubChem CID 135755303) has the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. Its IUPAC name is 2-amino-4a,8-dihydropteridine-4,7-dione.
| Compound Name | 2-amino-4a,8-dihydropteridine-4,7-dione |
|---|---|
| PubChem CID | 135755303 |
| Molecular Formula | C6H5N5O2 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-amino-4a,8-dihydropteridine-4,7-dione |
| SMILES | NC1=NC(=O)C2N=CC(=O)NC2=N1 |
| InChI | InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)8-1-2(12)9-4/h1,3H,(H3,7,9,10,11,12,13) |
| InChIKey | DLRHVWIHACTDAE-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |