C16H16N2O6S4 — CID 23422983
3-[[[2-sulfanylidene-2-[(3-sulfophenyl)methylamino]ethanethioyl]amino]methyl]benzenesulfonic acid (PubChem CID 23422983) has the molecular formula C16H16N2O6S4 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[[[2-sulfanylidene-2-[(3-sulfophenyl)methylamino]ethanethioyl]amino]methyl]benzenesulfonic acid.
| Compound Name | 3-[[[2-sulfanylidene-2-[(3-sulfophenyl)methylamino]ethanethioyl]amino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 23422983 |
| Molecular Formula | C16H16N2O6S4 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 3-[[[2-sulfanylidene-2-[(3-sulfophenyl)methylamino]ethanethioyl]amino]methyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(CNC(=S)C(=S)NCc2cccc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C16H16N2O6S4/c19-27(20,21)13-5-1-3-11(7-13)9-17-15(25)16(26)18-10-12-4-2-6-14(8-12)28(22,23)24/h1-8H,9-10H2,(H,17,25)(H,18,26)(H,19,20,21)(H,22,23,24) |
| InChIKey | SZYOWVCOKLWNGI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|