C18H32O3 — CID 23426355
(5E,9E,13R)-13,14-dihydroxy-6,10,14-trimethylpentadeca-5,9-dien-2-one (PubChem CID 23426355) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (5E,9E,13R)-13,14-dihydroxy-6,10,14-trimethylpentadeca-5,9-dien-2-one.
| Compound Name | (5E,9E,13R)-13,14-dihydroxy-6,10,14-trimethylpentadeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 23426355 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (5E,9E,13R)-13,14-dihydroxy-6,10,14-trimethylpentadeca-5,9-dien-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C18H32O3/c1-14(10-7-11-16(3)19)8-6-9-15(2)12-13-17(20)18(4,5)21/h9-10,17,20-21H,6-8,11-13H2,1-5H3/b14-10+,15-9+/t17-/m1/s1 |
| InChIKey | ANMUQNHDGYFRPB-VRJBOTSMSA-N |
| XLogP | 3.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|