C20H17F2N2OPS — CID 2342638
1-(difluoromethoxy)-4-[(diphenylphosphinothioylhydrazinylidene)methyl]benzene (PubChem CID 2342638) has the molecular formula C20H17F2N2OPS and a molecular weight of 402.41 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[(diphenylphosphinothioylhydrazinylidene)methyl]benzene.
| Compound Name | 1-(difluoromethoxy)-4-[(diphenylphosphinothioylhydrazinylidene)methyl]benzene |
|---|---|
| PubChem CID | 2342638 |
| Molecular Formula | C20H17F2N2OPS |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1-(difluoromethoxy)-4-[(diphenylphosphinothioylhydrazinylidene)methyl]benzene |
| SMILES | FC(F)Oc1ccc(C=NNP(=S)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17F2N2OPS/c21-20(22)25-17-13-11-16(12-14-17)15-23-24-26(27,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15,20H,(H,24,27) |
| InChIKey | VMZPKNPJWRGOBF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|