C36H54O6S — CID 23427486
[(5aS,10bR)-9-hydroxy-5a,10b-dimethyl-3-[(1S,6R,7S)-1,6,7,11,11-pentamethyl-2-oxatricyclo[8.4.0.03,7]tetradecan-6-yl]-1,2,3,3a,4,5,10,10a-octahydrocyclopenta[a]fluoren-6-yl] hydrogen sulfate (PubChem CID 23427486) has the molecular formula C36H54O6S and a molecular weight of 614.89 g/mol. Its IUPAC name is [(5aS,10bR)-9-hydroxy-5a,10b-dimethyl-3-[(1S,6R,7S)-1,6,7,11,11-pentamethyl-2-oxatricyclo[8.4.0.03,7]tetradecan-6-yl]-1,2,3,3a,4,5,10,10a-octahydrocyclopenta[a]fluoren-6-yl] hydrogen sulfate.
| Compound Name | [(5aS,10bR)-9-hydroxy-5a,10b-dimethyl-3-[(1S,6R,7S)-1,6,7,11,11-pentamethyl-2-oxatricyclo[8.4.0.03,7]tetradecan-6-yl]-1,2,3,3a,4,5,10,10a-octahydrocyclopenta[a]fluoren-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 23427486 |
| Molecular Formula | C36H54O6S |
| Molecular Weight | 614.89 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | [(5aS,10bR)-9-hydroxy-5a,10b-dimethyl-3-[(1S,6R,7S)-1,6,7,11,11-pentamethyl-2-oxatricyclo[8.4.0.03,7]tetradecan-6-yl]-1,2,3,3a,4,5,10,10a-octahydrocyclopenta[a]fluoren-6-yl] hydrogen sulfate |
| SMILES | CC1(C)CCC[C@]2(C)OC3CC[C@](C)(C4CC[C@]5(C)C4CC[C@]4(C)c6c(OS(=O)(=O)O)ccc(O)c6CC54)[C@]3(C)CCC12 |
| InChI | InChI=1S/C36H54O6S/c1-31(2)15-8-16-36(7)27(31)13-19-35(6)29(41-36)14-20-34(35,5)24-12-17-32(3)23(24)11-18-33(4)28(32)21-22-25(37)9-10-26(30(22)33)42-43(38,39)40/h9-10,23-24,27-29,37H,8,11-21H2,1-7H3,(H,38,39,40)/t23?,24?,27?,28?,29?,32-,33+,34-,35-,36+/m1/s1 |
| InChIKey | SBSIVJLISKXNGA-IYVAYJQYSA-N |
| XLogP | 8.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.89 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|