C16H22O3 — CID 586080
5,5-dimethyl-6,7,8,9,10,10a-hexahydroanthracene-1,4,8a-triol (PubChem CID 586080) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5,5-dimethyl-6,7,8,9,10,10a-hexahydroanthracene-1,4,8a-triol.
| Compound Name | 5,5-dimethyl-6,7,8,9,10,10a-hexahydroanthracene-1,4,8a-triol |
|---|---|
| PubChem CID | 586080 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5,5-dimethyl-6,7,8,9,10,10a-hexahydroanthracene-1,4,8a-triol |
| SMILES | CC1(C)CCCC2(O)Cc3c(O)ccc(O)c3CC12 |
| InChI | InChI=1S/C16H22O3/c1-15(2)6-3-7-16(19)9-11-10(8-14(15)16)12(17)4-5-13(11)18/h4-5,14,17-19H,3,6-9H2,1-2H3 |
| InChIKey | STRGITGQLGORKH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|