C37H45NO6S — CID 23431375
7-isocyano-2,12-dimethyl-2,12-bis(4-methylphenyl)-7-(4-methylphenyl)sulfonyltridecanedioic acid (PubChem CID 23431375) has the molecular formula C37H45NO6S and a molecular weight of 631.84 g/mol. Its IUPAC name is 7-isocyano-2,12-dimethyl-2,12-bis(4-methylphenyl)-7-(4-methylphenyl)sulfonyltridecanedioic acid.
| Compound Name | 7-isocyano-2,12-dimethyl-2,12-bis(4-methylphenyl)-7-(4-methylphenyl)sulfonyltridecanedioic acid |
|---|---|
| PubChem CID | 23431375 |
| Molecular Formula | C37H45NO6S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 7-isocyano-2,12-dimethyl-2,12-bis(4-methylphenyl)-7-(4-methylphenyl)sulfonyltridecanedioic acid |
| SMILES | [C-]#[N+]C(CCCCC(C)(C(=O)O)c1ccc(C)cc1)(CCCCC(C)(C(=O)O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H45NO6S/c1-27-11-17-30(18-12-27)35(4,33(39)40)23-7-9-25-37(38-6,45(43,44)32-21-15-29(3)16-22-32)26-10-8-24-36(5,34(41)42)31-19-13-28(2)14-20-31/h11-22H,7-10,23-26H2,1-5H3,(H,39,40)(H,41,42) |
| InChIKey | YGYDVHYOTGFVRF-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|