C15H19NO4S — CID 87406047
2-[isocyano-(4-methylphenyl)sulfonylmethyl]-3,3-dimethylbutanoic acid (PubChem CID 87406047) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[isocyano-(4-methylphenyl)sulfonylmethyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[isocyano-(4-methylphenyl)sulfonylmethyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87406047 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[isocyano-(4-methylphenyl)sulfonylmethyl]-3,3-dimethylbutanoic acid |
| SMILES | [C-]#[N+]C(C(C(=O)O)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-10-6-8-11(9-7-10)21(19,20)13(16-5)12(14(17)18)15(2,3)4/h6-9,12-13H,1-4H3,(H,17,18) |
| InChIKey | JXJRXRUGWITXMF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|