C35H57NO6S — CID 11479085
diethyl 10-isocyano-2,2,18,18-tetramethyl-10-(4-methylphenyl)sulfonylnonadecanedioate (PubChem CID 11479085) has the molecular formula C35H57NO6S and a molecular weight of 619.91 g/mol. Its IUPAC name is diethyl 10-isocyano-2,2,18,18-tetramethyl-10-(4-methylphenyl)sulfonylnonadecanedioate.
| Compound Name | diethyl 10-isocyano-2,2,18,18-tetramethyl-10-(4-methylphenyl)sulfonylnonadecanedioate |
|---|---|
| PubChem CID | 11479085 |
| Molecular Formula | C35H57NO6S |
| Molecular Weight | 619.91 g/mol |
| Exact Mass | 619.39 |
| IUPAC Name | diethyl 10-isocyano-2,2,18,18-tetramethyl-10-(4-methylphenyl)sulfonylnonadecanedioate |
| SMILES | [C-]#[N+]C(CCCCCCCC(C)(C)C(=O)OCC)(CCCCCCCC(C)(C)C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H57NO6S/c1-9-41-31(37)33(4,5)25-17-13-11-15-19-27-35(36-8,43(39,40)30-23-21-29(3)22-24-30)28-20-16-12-14-18-26-34(6,7)32(38)42-10-2/h21-24H,9-20,25-28H2,1-7H3 |
| InChIKey | OOHMZIXWSXRYFO-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.91 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|