C14H24O5 — CID 23431557
(3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2,5-trimethyl-4-oxohex-5-enoate (PubChem CID 23431557) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2,5-trimethyl-4-oxohex-5-enoate.
| Compound Name | (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2,5-trimethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 23431557 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2,5-trimethyl-4-oxohex-5-enoate |
| SMILES | C=C(C)C(=O)C(O)C(C)(C)C(=O)OCC(C)(C)CO |
| InChI | InChI=1S/C14H24O5/c1-9(2)10(16)11(17)14(5,6)12(18)19-8-13(3,4)7-15/h11,15,17H,1,7-8H2,2-6H3 |
| InChIKey | VPFBDJOPPIBMKX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|