C21H28Cl2N4O4S — CID 23447507
4-[(7-chloro-2H-chromen-3-yl)sulfonyl]-1-[(1-ethanimidoylpiperidin-4-yl)methyl]piperazin-2-one;hydrochloride (PubChem CID 23447507) has the molecular formula C21H28Cl2N4O4S and a molecular weight of 503.45 g/mol. Its IUPAC name is 4-[(7-chloro-2H-chromen-3-yl)sulfonyl]-1-[(1-ethanimidoylpiperidin-4-yl)methyl]piperazin-2-one;hydrochloride.
| Compound Name | 4-[(7-chloro-2H-chromen-3-yl)sulfonyl]-1-[(1-ethanimidoylpiperidin-4-yl)methyl]piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 23447507 |
| Molecular Formula | C21H28Cl2N4O4S |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 4-[(7-chloro-2H-chromen-3-yl)sulfonyl]-1-[(1-ethanimidoylpiperidin-4-yl)methyl]piperazin-2-one;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)N1CCC(CN2CCN(S(=O)(=O)C3=Cc4ccc(Cl)cc4OC3)CC2=O)CC1 |
| InChI | InChI=1S/C21H27ClN4O4S.ClH/c1-15(23)24-6-4-16(5-7-24)12-25-8-9-26(13-21(25)27)31(28,29)19-10-17-2-3-18(22)11-20(17)30-14-19;/h2-3,10-11,16,23H,4-9,12-14H2,1H3;1H/b23-15+; |
| InChIKey | NMWNEAGXIICVAO-BUGNPGDCSA-N |
| XLogP | 2.68 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|