C25H50N4 — CID 23451977
2-propyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinane (PubChem CID 23451977) has the molecular formula C25H50N4 and a molecular weight of 406.70 g/mol. Its IUPAC name is 2-propyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinane.
| Compound Name | 2-propyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinane |
|---|---|
| PubChem CID | 23451977 |
| Molecular Formula | C25H50N4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.40 |
| IUPAC Name | 2-propyl-1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinane |
| SMILES | CCCC1N(C2CC(C)(C)NC(C)(C)C2)CCCN1C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H50N4/c1-10-12-21-28(19-15-22(2,3)26-23(4,5)16-19)13-11-14-29(21)20-17-24(6,7)27-25(8,9)18-20/h19-21,26-27H,10-18H2,1-9H3 |
| InChIKey | STHSQIKBRQTLHM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |