C16H19N3O2 — CID 23459988
prop-2-enyl 2-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 23459988) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is prop-2-enyl 2-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | prop-2-enyl 2-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 23459988 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | prop-2-enyl 2-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN=C1Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C16H19N3O2/c1-2-11-21-16(20)19-10-9-17-15(19)18-14-8-4-6-12-5-3-7-13(12)14/h2,4,6,8H,1,3,5,7,9-11H2,(H,17,18) |
| InChIKey | LQRCNKURGAYJSH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|