C15H25BrO7 — CID 23460112
2-bromo-3,5,6-trimethylbenzene-1,4-diol;dimethoxymethoxy(dimethoxy)methane (PubChem CID 23460112) has the molecular formula C15H25BrO7 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-bromo-3,5,6-trimethylbenzene-1,4-diol;dimethoxymethoxy(dimethoxy)methane.
| Compound Name | 2-bromo-3,5,6-trimethylbenzene-1,4-diol;dimethoxymethoxy(dimethoxy)methane |
|---|---|
| PubChem CID | 23460112 |
| Molecular Formula | C15H25BrO7 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-bromo-3,5,6-trimethylbenzene-1,4-diol;dimethoxymethoxy(dimethoxy)methane |
| SMILES | COC(OC)OC(OC)OC.Cc1c(C)c(O)c(Br)c(C)c1O |
| InChI | InChI=1S/C9H11BrO2.C6H14O5/c1-4-5(2)9(12)7(10)6(3)8(4)11;1-7-5(8-2)11-6(9-3)10-4/h11-12H,1-3H3;5-6H,1-4H3 |
| InChIKey | DESWDHYAWPRAIA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|