About 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol
4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol (PubChem CID 117110781) has the molecular formula C10H14BrNO
and a molecular weight of 244.13 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol |
| PubChem CID | 117110781 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol |
| SMILES | Cc1c(C)c(CN)c(C)c(Br)c1O |
| InChI | InChI=1S/C10H14BrNO/c1-5-6(2)10(13)9(11)7(3)8(5)4-12/h13H,4,12H2,1-3H3 |
| InChIKey | DUNTVHDDMPXDEX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol?
The IUPAC name of 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol (CID 117110781) is 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol.
What is the SMILES notation for 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol?
The canonical SMILES for 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol is Cc1c(C)c(CN)c(C)c(Br)c1O.
What is the InChIKey of 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol?
The InChIKey is DUNTVHDDMPXDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNO/c1-5-6(2)10(13)9(11)7(3)8(5)4-12/h13H,4,12H2,1-3H3.
What are the key properties of 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol?
4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol has a molecular weight of 244.13 g/mol, XLogP of 2.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-2-bromo-3,5,6-trimethylphenol is sourced from PubChem (CID 117110781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).