C21H31ClN2O2 — CID 23460356
2-(2,5-dimethoxyanilino)ethyl-[(4-ethylphenyl)methyl]-dimethylazanium chloride (PubChem CID 23460356) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)ethyl-[(4-ethylphenyl)methyl]-dimethylazanium chloride.
| Compound Name | 2-(2,5-dimethoxyanilino)ethyl-[(4-ethylphenyl)methyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 23460356 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)ethyl-[(4-ethylphenyl)methyl]-dimethylazanium chloride |
| SMILES | CCc1ccc(C[N+](C)(C)CCNc2cc(OC)ccc2OC)cc1.[Cl-] |
| InChI | InChI=1S/C21H31N2O2.ClH/c1-6-17-7-9-18(10-8-17)16-23(2,3)14-13-22-20-15-19(24-4)11-12-21(20)25-5;/h7-12,15,22H,6,13-14,16H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | XYAOJAVMVSEATN-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|