About 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate
3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate (PubChem CID 23469081) has the molecular formula C10H8INO3
and a molecular weight of 317.08 g/mol. Its IUPAC name is 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate.
Molecular Properties
| Compound Name | 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate |
| PubChem CID | 23469081 |
| Molecular Formula | C10H8INO3 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate |
| SMILES | O=C(OCC#CI)OCc1ccncc1 |
| InChI | InChI=1S/C10H8INO3/c11-4-1-7-14-10(13)15-8-9-2-5-12-6-3-9/h2-3,5-6H,7-8H2 |
| InChIKey | SGKPCYQLSOQROJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate?
The IUPAC name of 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate (CID 23469081) is 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate.
What is the SMILES notation for 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate?
The canonical SMILES for 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate is O=C(OCC#CI)OCc1ccncc1.
What is the InChIKey of 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate?
The InChIKey is SGKPCYQLSOQROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8INO3/c11-4-1-7-14-10(13)15-8-9-2-5-12-6-3-9/h2-3,5-6H,7-8H2.
What are the key properties of 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate?
3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate has a molecular weight of 317.08 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-2-ynyl pyridin-4-ylmethyl carbonate is sourced from PubChem (CID 23469081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).