C18H24N2O4 — CID 23470320
2-[3-(dimethylamino)-6,7-dimethoxy-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 23470320) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6,7-dimethoxy-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-(dimethylamino)-6,7-dimethoxy-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 23470320 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[3-(dimethylamino)-6,7-dimethoxy-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | COc1cc2c3c(n(CC(=O)O)c2cc1OC)CCC(N(C)C)C3 |
| InChI | InChI=1S/C18H24N2O4/c1-19(2)11-5-6-14-12(7-11)13-8-16(23-3)17(24-4)9-15(13)20(14)10-18(21)22/h8-9,11H,5-7,10H2,1-4H3,(H,21,22) |
| InChIKey | SVVKAUPXERGCCY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|