C24H18ClNO3 — CID 23472032
(E)-3-(2-chlorophenyl)-N-(6,7-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide (PubChem CID 23472032) has the molecular formula C24H18ClNO3 and a molecular weight of 403.87 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(6,7-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(6,7-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23472032 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(6,7-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide |
| SMILES | Cc1cc2oc3cc(NC(=O)/C=C/c4ccccc4Cl)ccc3c(=O)c2cc1C |
| InChI | InChI=1S/C24H18ClNO3/c1-14-11-19-21(12-15(14)2)29-22-13-17(8-9-18(22)24(19)28)26-23(27)10-7-16-5-3-4-6-20(16)25/h3-13H,1-2H3,(H,26,27)/b10-7+ |
| InChIKey | YNSJKICYSBVASZ-JXMROGBWSA-N |
| XLogP | 5.87 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|