C18H16N6O5 — CID 23479186
1-[6-(3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine (PubChem CID 23479186) has the molecular formula C18H16N6O5 and a molecular weight of 396.36 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine.
| Compound Name | 1-[6-(3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine |
|---|---|
| PubChem CID | 23479186 |
| Molecular Formula | C18H16N6O5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[6-(3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2-(4-nitrophenyl)hydrazine |
| SMILES | Cc1cc(C)cc(Oc2ncnc(NNc3ccc([N+](=O)[O-])cc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O5/c1-11-7-12(2)9-15(8-11)29-18-16(24(27)28)17(19-10-20-18)22-21-13-3-5-14(6-4-13)23(25)26/h3-10,21H,1-2H3,(H,19,20,22) |
| InChIKey | NKQIULYNNPPAJB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|