C20H27N5O4 — CID 23480104
N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23480104) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23480104 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(CCNc2ncnc(N3CCCC(C)C3)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H27N5O4/c1-14-5-4-10-24(12-14)20-18(25(26)27)19(22-13-23-20)21-9-8-15-6-7-16(28-2)17(11-15)29-3/h6-7,11,13-14H,4-5,8-10,12H2,1-3H3,(H,21,22,23) |
| InChIKey | RLACNINPBPWTNM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|