C21H21Cl2N3O3S — CID 23497410
2-[2-[4-[(2,4-dichlorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethoxy]acetic acid (PubChem CID 23497410) has the molecular formula C21H21Cl2N3O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-[2-[4-[(2,4-dichlorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(2,4-dichlorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 23497410 |
| Molecular Formula | C21H21Cl2N3O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-[2-[4-[(2,4-dichlorophenyl)methylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCc1nc(NCc2ccc(Cl)cc2Cl)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C21H21Cl2N3O3S/c22-13-6-5-12(15(23)9-13)10-24-20-19-14-3-1-2-4-16(14)30-21(19)26-17(25-20)7-8-29-11-18(27)28/h5-6,9H,1-4,7-8,10-11H2,(H,27,28)(H,24,25,26) |
| InChIKey | ZVEKERRHSJWECS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|