C20H18F3N3O2 — CID 23515827
1-cyclopentyl-2-[4-(trifluoromethoxy)phenyl]benzimidazole-5-carboxamide (PubChem CID 23515827) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-cyclopentyl-2-[4-(trifluoromethoxy)phenyl]benzimidazole-5-carboxamide.
| Compound Name | 1-cyclopentyl-2-[4-(trifluoromethoxy)phenyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 23515827 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-cyclopentyl-2-[4-(trifluoromethoxy)phenyl]benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(-c1ccc(OC(F)(F)F)cc1)n2C1CCCC1 |
| InChI | InChI=1S/C20H18F3N3O2/c21-20(22,23)28-15-8-5-12(6-9-15)19-25-16-11-13(18(24)27)7-10-17(16)26(19)14-3-1-2-4-14/h5-11,14H,1-4H2,(H2,24,27) |
| InChIKey | ZWEGRQBBEVNUJV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |