C13H19O3S+ — CID 23522374
2,3-dihydroxypropyl-ethyl-phenacylsulfanium (PubChem CID 23522374) has the molecular formula C13H19O3S+ and a molecular weight of 255.36 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-ethyl-phenacylsulfanium.
| Compound Name | 2,3-dihydroxypropyl-ethyl-phenacylsulfanium |
|---|---|
| PubChem CID | 23522374 |
| Molecular Formula | C13H19O3S+ |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2,3-dihydroxypropyl-ethyl-phenacylsulfanium |
| SMILES | CC[S+](CC(=O)c1ccccc1)CC(O)CO |
| InChI | InChI=1S/C13H19O3S/c1-2-17(9-12(15)8-14)10-13(16)11-6-4-3-5-7-11/h3-7,12,14-15H,2,8-10H2,1H3/q+1 |
| InChIKey | SJTZGLLSCDQOEV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|