C12H15NO3 — CID 57141172
2-(3,4-dihydroxybutylideneamino)-1-phenylethanone (PubChem CID 57141172) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(3,4-dihydroxybutylideneamino)-1-phenylethanone.
| Compound Name | 2-(3,4-dihydroxybutylideneamino)-1-phenylethanone |
|---|---|
| PubChem CID | 57141172 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(3,4-dihydroxybutylideneamino)-1-phenylethanone |
| SMILES | O=C(C/N=C/CC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c14-9-11(15)6-7-13-8-12(16)10-4-2-1-3-5-10/h1-5,7,11,14-15H,6,8-9H2/b13-7+ |
| InChIKey | FBOYGFVEYMCPJW-NTUHNPAUSA-N |
| XLogP | 0.68 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|