C37H34N6 — CID 23523630
4-[[4-[[4-[(4-butylphenyl)methylamino]naphthalen-1-yl]diazenyl]phenyl]diazenyl]naphthalen-1-amine (PubChem CID 23523630) has the molecular formula C37H34N6 and a molecular weight of 562.72 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-butylphenyl)methylamino]naphthalen-1-yl]diazenyl]phenyl]diazenyl]naphthalen-1-amine.
| Compound Name | 4-[[4-[[4-[(4-butylphenyl)methylamino]naphthalen-1-yl]diazenyl]phenyl]diazenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 23523630 |
| Molecular Formula | C37H34N6 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 4-[[4-[[4-[(4-butylphenyl)methylamino]naphthalen-1-yl]diazenyl]phenyl]diazenyl]naphthalen-1-amine |
| SMILES | CCCCc1ccc(CNc2ccc(/N=N/c3ccc(/N=N/c4ccc(N)c5ccccc45)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H34N6/c1-2-3-8-26-13-15-27(16-14-26)25-39-35-23-24-37(33-12-7-6-11-32(33)35)43-41-29-19-17-28(18-20-29)40-42-36-22-21-34(38)30-9-4-5-10-31(30)36/h4-7,9-24,39H,2-3,8,25,38H2,1H3/b42-40+,43-41+ |
| InChIKey | RCKLHHVCPABUSD-IZRQRQPJSA-N |
| XLogP | 11.36 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|