C18H19ClN4 — CID 117067404
N'-(4-phenyldiazenylnaphthalen-1-yl)ethane-1,2-diamine;hydrochloride (PubChem CID 117067404) has the molecular formula C18H19ClN4 and a molecular weight of 326.83 g/mol. Its IUPAC name is N'-(4-phenyldiazenylnaphthalen-1-yl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(4-phenyldiazenylnaphthalen-1-yl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 117067404 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N'-(4-phenyldiazenylnaphthalen-1-yl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCNc1ccc(/N=N/c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C18H18N4.ClH/c19-12-13-20-17-10-11-18(16-9-5-4-8-15(16)17)22-21-14-6-2-1-3-7-14;/h1-11,20H,12-13,19H2;1H/b22-21+; |
| InChIKey | HKJWMMOTESBZEZ-QUABFQRHSA-N |
| XLogP | 5.05 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|