C23H28N4S — CID 97355875
N',N'-diethyl-N-[4-[(2-methylsulfanylphenyl)diazenyl]naphthalen-1-yl]ethane-1,2-diamine (PubChem CID 97355875) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is N',N'-diethyl-N-[4-[(2-methylsulfanylphenyl)diazenyl]naphthalen-1-yl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[4-[(2-methylsulfanylphenyl)diazenyl]naphthalen-1-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 97355875 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N',N'-diethyl-N-[4-[(2-methylsulfanylphenyl)diazenyl]naphthalen-1-yl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(/N=N/c2ccccc2SC)c2ccccc12 |
| InChI | InChI=1S/C23H28N4S/c1-4-27(5-2)17-16-24-20-14-15-21(19-11-7-6-10-18(19)20)25-26-22-12-8-9-13-23(22)28-3/h6-15,24H,4-5,16-17H2,1-3H3/b26-25+ |
| InChIKey | ZTNGZMPTQQNHDS-OCEACIFDSA-N |
| XLogP | 6.73 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|