C43H45F6NO9Si — CID 23524630
[4-(4-acetylphenyl)-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoyl]oxyphenyl]pentyl] 2-trimethoxysilylazetidine-1-carboxylate (PubChem CID 23524630) has the molecular formula C43H45F6NO9Si and a molecular weight of 861.91 g/mol. Its IUPAC name is [4-(4-acetylphenyl)-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoyl]oxyphenyl]pentyl] 2-trimethoxysilylazetidine-1-carboxylate.
| Compound Name | [4-(4-acetylphenyl)-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoyl]oxyphenyl]pentyl] 2-trimethoxysilylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 23524630 |
| Molecular Formula | C43H45F6NO9Si |
| Molecular Weight | 861.91 g/mol |
| Exact Mass | 861.28 |
| IUPAC Name | [4-(4-acetylphenyl)-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoyl]oxyphenyl]pentyl] 2-trimethoxysilylazetidine-1-carboxylate |
| SMILES | COc1ccc(C(c2ccc(C(=O)Oc3ccc(C(C)(CCCOC(=O)N4CCC4[Si](OC)(OC)OC)c4ccc(C(C)=O)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C43H45F6NO9Si/c1-28(51)29-8-12-31(13-9-29)40(2,25-7-27-58-39(53)50-26-24-37(50)60(55-4,56-5)57-6)32-16-22-36(23-17-32)59-38(52)30-10-14-33(15-11-30)41(42(44,45)46,43(47,48)49)34-18-20-35(54-3)21-19-34/h8-23,37H,7,24-27H2,1-6H3 |
| InChIKey | GTDBTPIMKKGQML-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.91 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|