C46H53F6NO9Si — CID 91146175
[4-[2-(4-acetylphenyl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate (PubChem CID 91146175) has the molecular formula C46H53F6NO9Si and a molecular weight of 906.00 g/mol. Its IUPAC name is [4-[2-(4-acetylphenyl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate.
| Compound Name | [4-[2-(4-acetylphenyl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 91146175 |
| Molecular Formula | C46H53F6NO9Si |
| Molecular Weight | 906.00 g/mol |
| Exact Mass | 905.34 |
| IUPAC Name | [4-[2-(4-acetylphenyl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
| SMILES | CCO[Si](CCCNC(=O)OCCCC(C)(c1ccc(OC(=O)c2ccc(C(c3ccc(OC)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1)c1ccc(C(C)=O)cc1)(OCC)OCC |
| InChI | InChI=1S/C46H53F6NO9Si/c1-7-59-63(60-8-2,61-9-3)31-11-29-53-42(56)58-30-10-28-43(5,35-16-12-33(13-17-35)32(4)54)36-20-26-40(27-21-36)62-41(55)34-14-18-37(19-15-34)44(45(47,48)49,46(50,51)52)38-22-24-39(57-6)25-23-38/h12-27H,7-11,28-31H2,1-6H3,(H,53,56) |
| InChIKey | JDXDRSDLHKOMAY-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.00 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|