C43H51NO11Si — CID 91379114
[4-[1-[4-[4-[2-(4-methoxyphenyl)-5-(3-trihydroxysilylpropylcarbamoyloxy)pentan-2-yl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate (PubChem CID 91379114) has the molecular formula C43H51NO11Si and a molecular weight of 785.96 g/mol. Its IUPAC name is [4-[1-[4-[4-[2-(4-methoxyphenyl)-5-(3-trihydroxysilylpropylcarbamoyloxy)pentan-2-yl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-[4-[4-[2-(4-methoxyphenyl)-5-(3-trihydroxysilylpropylcarbamoyloxy)pentan-2-yl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 91379114 |
| Molecular Formula | C43H51NO11Si |
| Molecular Weight | 785.96 g/mol |
| Exact Mass | 785.32 |
| IUPAC Name | [4-[1-[4-[4-[2-(4-methoxyphenyl)-5-(3-trihydroxysilylpropylcarbamoyloxy)pentan-2-yl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
| SMILES | COc1ccc(C(C)(CCCOC(=O)NCCC[Si](O)(O)O)c2ccc(OC(=O)Oc3ccc(C4(c5ccc(OC(C)=O)cc5)CCCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H51NO11Si/c1-31(45)53-37-21-13-34(14-22-37)43(26-5-4-6-27-43)35-15-23-39(24-16-35)55-41(47)54-38-19-11-33(12-20-38)42(2,32-9-17-36(51-3)18-10-32)25-7-29-52-40(46)44-28-8-30-56(48,49)50/h9-24,48-50H,4-8,25-30H2,1-3H3,(H,44,46) |
| InChIKey | UTTUXZFHIZJBMK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 170.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.96 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|