C35H42O5 — CID 58760893
[4-[1-[4-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate (PubChem CID 58760893) has the molecular formula C35H42O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is [4-[1-[4-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-[4-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 58760893 |
| Molecular Formula | C35H42O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | [4-[1-[4-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2(c3ccc(OC(=O)Oc4ccc(C(C)(C)CC(C)(C)C)cc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C35H42O5/c1-25(36)38-29-18-12-27(13-19-29)35(22-8-7-9-23-35)28-14-20-31(21-15-28)40-32(37)39-30-16-10-26(11-17-30)34(5,6)24-33(2,3)4/h10-21H,7-9,22-24H2,1-6H3 |
| InChIKey | DWHBVWXDEQJMBE-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|