C27H40N6O5 — CID 23526994
tert-butyl N-[1-[5-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]azetidin-3-yl]carbamate (PubChem CID 23526994) has the molecular formula C27H40N6O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 23526994 |
| Molecular Formula | C27H40N6O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | tert-butyl N-[1-[5-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2ccc(-c3noc(C(CCCC4CCCCC4)CC(=O)NO)n3)cn2)C1 |
| InChI | InChI=1S/C27H40N6O5/c1-27(2,3)37-26(35)29-21-16-33(17-21)22-13-12-20(15-28-22)24-30-25(38-32-24)19(14-23(34)31-36)11-7-10-18-8-5-4-6-9-18/h12-13,15,18-19,21,36H,4-11,14,16-17H2,1-3H3,(H,29,35)(H,31,34) |
| InChIKey | IENOMXUNWCKEPT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|