C24H14F6N2Pt — CID 23528003
1,3-bis(trifluoromethyl)benzene-2-ide;2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) (PubChem CID 23528003) has the molecular formula C24H14F6N2Pt and a molecular weight of 639.46 g/mol. Its IUPAC name is 1,3-bis(trifluoromethyl)benzene-2-ide;2-phenyl-6-pyridin-2-ylpyridine;platinum(2+).
| Compound Name | 1,3-bis(trifluoromethyl)benzene-2-ide;2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 23528003 |
| Molecular Formula | C24H14F6N2Pt |
| Molecular Weight | 639.46 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | 1,3-bis(trifluoromethyl)benzene-2-ide;2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) |
| SMILES | FC(F)(F)c1[c-]c(C(F)(F)F)ccc1.[Pt+2].[c-]1ccccc1-c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H11N2.C8H3F6.Pt/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15;9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;/h1-7,9-12H;1-3H;/q2*-1;+2 |
| InChIKey | XGPVMUCXVFKOIL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.46 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|