C10H18N2O — CID 23529110
3,4-di(propan-2-yl)-1,4-dihydropyrimidin-2-one (PubChem CID 23529110) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,4-dihydropyrimidin-2-one.
| Compound Name | 3,4-di(propan-2-yl)-1,4-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 23529110 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,4-dihydropyrimidin-2-one |
| SMILES | CC(C)C1C=CNC(=O)N1C(C)C |
| InChI | InChI=1S/C10H18N2O/c1-7(2)9-5-6-11-10(13)12(9)8(3)4/h5-9H,1-4H3,(H,11,13) |
| InChIKey | GBYKCFBIFAYFNA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |